C38H25N3O2S — CID 122218800
(E)-2-cyano-3-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 122218800) has the molecular formula C38H25N3O2S and a molecular weight of 587.70 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 122218800 |
| Molecular Formula | C38H25N3O2S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(-n3c4ccccc4c4ccc(N(c5ccccc5)c5ccccc5)cc43)cc2)s1)C(=O)O |
| InChI | InChI=1S/C38H25N3O2S/c39-25-27(38(42)43)23-32-20-22-37(44-32)26-15-17-30(18-16-26)41-35-14-8-7-13-33(35)34-21-19-31(24-36(34)41)40(28-9-3-1-4-10-28)29-11-5-2-6-12-29/h1-24H,(H,42,43)/b27-23+ |
| InChIKey | ZCHCUPCSXHFPAH-SLEBQGDGSA-N |
| XLogP | 9.97 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|