C35H32F2N2O2 — CID 143793409
(Z)-3-[5-[4-[2,2-bis(4-fluorophenyl)ethenyl]phenyl]-3-hexyl-1-methylpyrrol-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 143793409) has the molecular formula C35H32F2N2O2 and a molecular weight of 550.65 g/mol. Its IUPAC name is (Z)-3-[5-[4-[2,2-bis(4-fluorophenyl)ethenyl]phenyl]-3-hexyl-1-methylpyrrol-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[4-[2,2-bis(4-fluorophenyl)ethenyl]phenyl]-3-hexyl-1-methylpyrrol-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 143793409 |
| Molecular Formula | C35H32F2N2O2 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (Z)-3-[5-[4-[2,2-bis(4-fluorophenyl)ethenyl]phenyl]-3-hexyl-1-methylpyrrol-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCc1cc(-c2ccc(C=C(c3ccc(F)cc3)c3ccc(F)cc3)cc2)n(C)c1/C=C(/C#N)C(=O)O |
| InChI | InChI=1S/C35H32F2N2O2/c1-3-4-5-6-7-28-21-33(39(2)34(28)22-29(23-38)35(40)41)27-10-8-24(9-11-27)20-32(25-12-16-30(36)17-13-25)26-14-18-31(37)19-15-26/h8-22H,3-7H2,1-2H3,(H,40,41)/b29-22- |
| InChIKey | RUYOJTHOEHBNRD-IADYIPOJSA-N |
| XLogP | 8.67 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|