C28H25FN2O2 — CID 132579391
(E)-2-cyano-3-[2-fluoro-4-(9-hexylcarbazol-3-yl)phenyl]prop-2-enoic acid (PubChem CID 132579391) has the molecular formula C28H25FN2O2 and a molecular weight of 440.52 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-fluoro-4-(9-hexylcarbazol-3-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[2-fluoro-4-(9-hexylcarbazol-3-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 132579391 |
| Molecular Formula | C28H25FN2O2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (E)-2-cyano-3-[2-fluoro-4-(9-hexylcarbazol-3-yl)phenyl]prop-2-enoic acid |
| SMILES | CCCCCCn1c2ccccc2c2cc(-c3ccc(/C=C(\C#N)C(=O)O)c(F)c3)ccc21 |
| InChI | InChI=1S/C28H25FN2O2/c1-2-3-4-7-14-31-26-9-6-5-8-23(26)24-16-19(12-13-27(24)31)20-10-11-21(25(29)17-20)15-22(18-30)28(32)33/h5-6,8-13,15-17H,2-4,7,14H2,1H3,(H,32,33)/b22-15+ |
| InChIKey | BYOUWTOPTJTCHZ-PXLXIMEGSA-N |
| XLogP | 7.17 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|