C22H21N3 — CID 102047016
2-[(9-hexylcarbazol-3-yl)methylidene]propanedinitrile (PubChem CID 102047016) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[(9-hexylcarbazol-3-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(9-hexylcarbazol-3-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 102047016 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-[(9-hexylcarbazol-3-yl)methylidene]propanedinitrile |
| SMILES | CCCCCCn1c2ccccc2c2cc(C=C(C#N)C#N)ccc21 |
| InChI | InChI=1S/C22H21N3/c1-2-3-4-7-12-25-21-9-6-5-8-19(21)20-14-17(10-11-22(20)25)13-18(15-23)16-24/h5-6,8-11,13-14H,2-4,7,12H2,1H3 |
| InChIKey | DWOOLQUKNGKOMT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|