C46H46N4O6 — CID 101056880
6-[(E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoyl]oxyhexyl (E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoate (PubChem CID 101056880) has the molecular formula C46H46N4O6 and a molecular weight of 750.90 g/mol. Its IUPAC name is 6-[(E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoyl]oxyhexyl (E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoate.
| Compound Name | 6-[(E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoyl]oxyhexyl (E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101056880 |
| Molecular Formula | C46H46N4O6 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.34 |
| IUPAC Name | 6-[(E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoyl]oxyhexyl (E)-2-cyano-3-[9-(4-hydroxybutyl)carbazol-3-yl]prop-2-enoate |
| SMILES | N#C/C(=C\c1ccc2c(c1)c1ccccc1n2CCCCO)C(=O)OCCCCCCOC(=O)/C(C#N)=C/c1ccc2c(c1)c1ccccc1n2CCCCO |
| InChI | InChI=1S/C46H46N4O6/c47-31-35(27-33-17-19-43-39(29-33)37-13-3-5-15-41(37)49(43)21-7-9-23-51)45(53)55-25-11-1-2-12-26-56-46(54)36(32-48)28-34-18-20-44-40(30-34)38-14-4-6-16-42(38)50(44)22-8-10-24-52/h3-6,13-20,27-30,51-52H,1-2,7-12,21-26H2/b35-27+,36-28+ |
| InChIKey | BHNWMYVASAQVMZ-JEVCVBCSSA-N |
| XLogP | 8.61 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|