C17H26N2O3 — CID 90257331
12-hydroxydodecyl (Z)-2,3-dicyanoprop-2-enoate (PubChem CID 90257331) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 12-hydroxydodecyl (Z)-2,3-dicyanoprop-2-enoate.
| Compound Name | 12-hydroxydodecyl (Z)-2,3-dicyanoprop-2-enoate |
|---|---|
| PubChem CID | 90257331 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 12-hydroxydodecyl (Z)-2,3-dicyanoprop-2-enoate |
| SMILES | N#C/C=C(/C#N)C(=O)OCCCCCCCCCCCCO |
| InChI | InChI=1S/C17H26N2O3/c18-12-11-16(15-19)17(21)22-14-10-8-6-4-2-1-3-5-7-9-13-20/h11,20H,1-10,13-14H2/b16-11- |
| InChIKey | DHNABYVQGULLPE-WJDWOHSUSA-N |
| XLogP | 3.40 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|