C41H36N4O4 — CID 59899418
6-methoxyhexyl (Z)-3-[9-[[3-[(E)-2-cyano-3-oxobut-1-enyl]carbazol-9-yl]methyl]carbazol-3-yl]-2-isocyanoprop-2-enoate (PubChem CID 59899418) has the molecular formula C41H36N4O4 and a molecular weight of 648.76 g/mol. Its IUPAC name is 6-methoxyhexyl (Z)-3-[9-[[3-[(E)-2-cyano-3-oxobut-1-enyl]carbazol-9-yl]methyl]carbazol-3-yl]-2-isocyanoprop-2-enoate.
| Compound Name | 6-methoxyhexyl (Z)-3-[9-[[3-[(E)-2-cyano-3-oxobut-1-enyl]carbazol-9-yl]methyl]carbazol-3-yl]-2-isocyanoprop-2-enoate |
|---|---|
| PubChem CID | 59899418 |
| Molecular Formula | C41H36N4O4 |
| Molecular Weight | 648.76 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | 6-methoxyhexyl (Z)-3-[9-[[3-[(E)-2-cyano-3-oxobut-1-enyl]carbazol-9-yl]methyl]carbazol-3-yl]-2-isocyanoprop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1ccc2c(c1)c1ccccc1n2Cn1c2ccccc2c2cc(/C=C(\C#N)C(C)=O)ccc21)C(=O)OCCCCCCOC |
| InChI | InChI=1S/C41H36N4O4/c1-28(46)31(26-42)22-29-16-18-39-34(23-29)32-12-6-8-14-37(32)44(39)27-45-38-15-9-7-13-33(38)35-24-30(17-19-40(35)45)25-36(43-2)41(47)49-21-11-5-4-10-20-48-3/h6-9,12-19,22-25H,4-5,10-11,20-21,27H2,1,3H3/b31-22+,36-25- |
| InChIKey | ZHFMOQOXGCTDPN-WXMGVJOHSA-N |
| XLogP | 8.91 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.76 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|