C48H30N4O4 — CID 59685487
(2E,4E)-5-[9-[4-[4-[3-[(1E,3Z)-4-carboxy-4-isocyanobuta-1,3-dienyl]carbazol-9-yl]phenyl]phenyl]carbazol-3-yl]-2-cyanopenta-2,4-dienoic acid (PubChem CID 59685487) has the molecular formula C48H30N4O4 and a molecular weight of 726.79 g/mol. Its IUPAC name is (2E,4E)-5-[9-[4-[4-[3-[(1E,3Z)-4-carboxy-4-isocyanobuta-1,3-dienyl]carbazol-9-yl]phenyl]phenyl]carbazol-3-yl]-2-cyanopenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[9-[4-[4-[3-[(1E,3Z)-4-carboxy-4-isocyanobuta-1,3-dienyl]carbazol-9-yl]phenyl]phenyl]carbazol-3-yl]-2-cyanopenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 59685487 |
| Molecular Formula | C48H30N4O4 |
| Molecular Weight | 726.79 g/mol |
| Exact Mass | 726.23 |
| IUPAC Name | (2E,4E)-5-[9-[4-[4-[3-[(1E,3Z)-4-carboxy-4-isocyanobuta-1,3-dienyl]carbazol-9-yl]phenyl]phenyl]carbazol-3-yl]-2-cyanopenta-2,4-dienoic acid |
| SMILES | [C-]#[N+]/C(=C\C=C\c1ccc2c(c1)c1ccccc1n2-c1ccc(-c2ccc(-n3c4ccccc4c4cc(/C=C/C=C(\C#N)C(=O)O)ccc43)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C48H30N4O4/c1-50-42(48(55)56)13-7-9-32-17-27-46-41(29-32)39-12-3-5-15-44(39)52(46)37-24-20-34(21-25-37)33-18-22-36(23-19-33)51-43-14-4-2-11-38(43)40-28-31(16-26-45(40)51)8-6-10-35(30-49)47(53)54/h2-29H,(H,53,54)(H,55,56)/b8-6+,9-7+,35-10+,42-13- |
| InChIKey | MSWVJWZAAWCITE-YMZSUAKOSA-N |
| XLogP | 11.00 |
| TPSA | 112.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.79 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|