C48H31N4O4+ — CID 147052758
5-[9-[4-[4-[3-(4-carboxy-4-cyanobuta-1,3-dienyl)carbazol-9-yl]phenyl]phenyl]-9H-carbazol-9-ium-3-yl]-2-cyanopenta-2,4-dienoic acid (PubChem CID 147052758) has the molecular formula C48H31N4O4+ and a molecular weight of 727.80 g/mol. Its IUPAC name is 5-[9-[4-[4-[3-(4-carboxy-4-cyanobuta-1,3-dienyl)carbazol-9-yl]phenyl]phenyl]-9H-carbazol-9-ium-3-yl]-2-cyanopenta-2,4-dienoic acid.
| Compound Name | 5-[9-[4-[4-[3-(4-carboxy-4-cyanobuta-1,3-dienyl)carbazol-9-yl]phenyl]phenyl]-9H-carbazol-9-ium-3-yl]-2-cyanopenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 147052758 |
| Molecular Formula | C48H31N4O4+ |
| Molecular Weight | 727.80 g/mol |
| Exact Mass | 727.23 |
| IUPAC Name | 5-[9-[4-[4-[3-(4-carboxy-4-cyanobuta-1,3-dienyl)carbazol-9-yl]phenyl]phenyl]-9H-carbazol-9-ium-3-yl]-2-cyanopenta-2,4-dienoic acid |
| SMILES | N#CC(=CC=Cc1ccc2c(c1)-c1ccccc1[NH+]2c1ccc(-c2ccc(-n3c4ccccc4c4cc(C=CC=C(C#N)C(=O)O)ccc43)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C48H30N4O4/c49-29-35(47(53)54)9-5-7-31-15-25-45-41(27-31)39-11-1-3-13-43(39)51(45)37-21-17-33(18-22-37)34-19-23-38(24-20-34)52-44-14-4-2-12-40(44)42-28-32(16-26-46(42)52)8-6-10-36(30-50)48(55)56/h1-28H,(H,53,54)(H,55,56)/p+1 |
| InChIKey | BBQJKBXTEVDFNS-UHFFFAOYSA-O |
| XLogP | 9.71 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.80 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|