C17H12N2O2 — CID 76652102
2-[3-(2-cyanoethenyl)carbazol-9-yl]acetic acid (PubChem CID 76652102) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-[3-(2-cyanoethenyl)carbazol-9-yl]acetic acid.
| Compound Name | 2-[3-(2-cyanoethenyl)carbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 76652102 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[3-(2-cyanoethenyl)carbazol-9-yl]acetic acid |
| SMILES | N#CC=Cc1ccc2c(c1)c1ccccc1n2CC(=O)O |
| InChI | InChI=1S/C17H12N2O2/c18-9-3-4-12-7-8-16-14(10-12)13-5-1-2-6-15(13)19(16)11-17(20)21/h1-8,10H,11H2,(H,20,21) |
| InChIKey | QEZBWEMOEZUQFI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|