C21H21N3O3 — CID 135122053
2-[3-(2-cyanoethenyl)carbazol-9-yl]-N-[(2S,3S)-1,3-dihydroxybutan-2-yl]acetamide (PubChem CID 135122053) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[3-(2-cyanoethenyl)carbazol-9-yl]-N-[(2S,3S)-1,3-dihydroxybutan-2-yl]acetamide.
| Compound Name | 2-[3-(2-cyanoethenyl)carbazol-9-yl]-N-[(2S,3S)-1,3-dihydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 135122053 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[3-(2-cyanoethenyl)carbazol-9-yl]-N-[(2S,3S)-1,3-dihydroxybutan-2-yl]acetamide |
| SMILES | C[C@H](O)[C@H](CO)NC(=O)Cn1c2ccccc2c2cc(C=CC#N)ccc21 |
| InChI | InChI=1S/C21H21N3O3/c1-14(26)18(13-25)23-21(27)12-24-19-7-3-2-6-16(19)17-11-15(5-4-10-22)8-9-20(17)24/h2-9,11,14,18,25-26H,12-13H2,1H3,(H,23,27)/t14-,18-/m0/s1 |
| InChIKey | ICCMDPBNIJPGOH-KSSFIOAISA-N |
| XLogP | 2.19 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|