C46H44N4O2S4 — CID 102100552
(E)-2-cyano-3-[4-(N-[4-[3-hexyl-5-[2-(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]phenyl]anilino)phenyl]prop-2-enoic acid (PubChem CID 102100552) has the molecular formula C46H44N4O2S4 and a molecular weight of 813.15 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(N-[4-[3-hexyl-5-[2-(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]phenyl]anilino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-(N-[4-[3-hexyl-5-[2-(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]phenyl]anilino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102100552 |
| Molecular Formula | C46H44N4O2S4 |
| Molecular Weight | 813.15 g/mol |
| Exact Mass | 812.23 |
| IUPAC Name | (E)-2-cyano-3-[4-(N-[4-[3-hexyl-5-[2-(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]phenyl]anilino)phenyl]prop-2-enoic acid |
| SMILES | CCCCCCc1csc(-c2nc3sc(-c4cc(CCCCCC)c(-c5ccc(N(c6ccccc6)c6ccc(/C=C(\C#N)C(=O)O)cc6)cc5)s4)nc3s2)c1 |
| InChI | InChI=1S/C46H44N4O2S4/c1-3-5-7-10-14-32-27-39(53-30-32)42-48-44-45(55-42)49-43(56-44)40-28-34(15-11-8-6-4-2)41(54-40)33-20-24-38(25-21-33)50(36-16-12-9-13-17-36)37-22-18-31(19-23-37)26-35(29-47)46(51)52/h9,12-13,16-28,30H,3-8,10-11,14-15H2,1-2H3,(H,51,52)/b35-26+ |
| InChIKey | MZOZHSORWANUBY-MDAYZVFASA-N |
| XLogP | 14.58 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.15 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|