C26H20O2S2 — CID 170961016
2-[5-(5-tert-butylthiophen-2-yl)thiophen-2-yl]anthracene-9,10-dione (PubChem CID 170961016) has the molecular formula C26H20O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[5-(5-tert-butylthiophen-2-yl)thiophen-2-yl]anthracene-9,10-dione.
| Compound Name | 2-[5-(5-tert-butylthiophen-2-yl)thiophen-2-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 170961016 |
| Molecular Formula | C26H20O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[5-(5-tert-butylthiophen-2-yl)thiophen-2-yl]anthracene-9,10-dione |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccc4c(c3)C(=O)c3ccccc3C4=O)s2)s1 |
| InChI | InChI=1S/C26H20O2S2/c1-26(2,3)23-13-12-22(30-23)21-11-10-20(29-21)15-8-9-18-19(14-15)25(28)17-7-5-4-6-16(17)24(18)27/h4-14H,1-3H3 |
| InChIKey | ZROOXFJMXPEANZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|