C7H7BF2O6 — CID 175492228
(3,6-difluoro-2-methoxyphenyl) dihydroxy borate (PubChem CID 175492228) has the molecular formula C7H7BF2O6 and a molecular weight of 235.94 g/mol. Its IUPAC name is (3,6-difluoro-2-methoxyphenyl) dihydroxy borate.
| Compound Name | (3,6-difluoro-2-methoxyphenyl) dihydroxy borate |
|---|---|
| PubChem CID | 175492228 |
| Molecular Formula | C7H7BF2O6 |
| Molecular Weight | 235.94 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (3,6-difluoro-2-methoxyphenyl) dihydroxy borate |
| SMILES | COc1c(F)ccc(F)c1OB(OO)OO |
| InChI | InChI=1S/C7H7BF2O6/c1-13-6-4(9)2-3-5(10)7(6)14-8(15-11)16-12/h2-3,11-12H,1H3 |
| InChIKey | XGRARJXYGBYNPH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.94 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|