C9H10F2O2 — CID 84661307
1-(3,6-difluoro-2-methoxyphenyl)ethanol (PubChem CID 84661307) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 1-(3,6-difluoro-2-methoxyphenyl)ethanol.
| Compound Name | 1-(3,6-difluoro-2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 84661307 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-(3,6-difluoro-2-methoxyphenyl)ethanol |
| SMILES | COc1c(F)ccc(F)c1C(C)O |
| InChI | InChI=1S/C9H10F2O2/c1-5(12)8-6(10)3-4-7(11)9(8)13-2/h3-5,12H,1-2H3 |
| InChIKey | RLWJQPCOMFBWEN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |