C10H12BrFO3 — CID 84714942
1-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)ethanol (PubChem CID 84714942) has the molecular formula C10H12BrFO3 and a molecular weight of 279.11 g/mol. Its IUPAC name is 1-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)ethanol.
| Compound Name | 1-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 84714942 |
| Molecular Formula | C10H12BrFO3 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)ethanol |
| SMILES | COc1cc(F)c(Br)c(C(C)O)c1OC |
| InChI | InChI=1S/C10H12BrFO3/c1-5(13)8-9(11)6(12)4-7(14-2)10(8)15-3/h4-5,13H,1-3H3 |
| InChIKey | KIGOJQXFURSBEJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |