C12H18F4N2 — CID 174760536
methane;1-methylpiperazine;1,2,3,4-tetrafluorobenzene (PubChem CID 174760536) has the molecular formula C12H18F4N2 and a molecular weight of 266.28 g/mol. Its IUPAC name is methane;1-methylpiperazine;1,2,3,4-tetrafluorobenzene.
| Compound Name | methane;1-methylpiperazine;1,2,3,4-tetrafluorobenzene |
|---|---|
| PubChem CID | 174760536 |
| Molecular Formula | C12H18F4N2 |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | methane;1-methylpiperazine;1,2,3,4-tetrafluorobenzene |
| SMILES | C.CN1CCNCC1.Fc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C6H2F4.C5H12N2.CH4/c7-3-1-2-4(8)6(10)5(3)9;1-7-4-2-6-3-5-7;/h1-2H;6H,2-5H2,1H3;1H4 |
| InChIKey | FLOKSJXKPTWCPU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|