C43H19BF16 — CID 139794522
hydron;tris(2,3,4,5-tetrafluorophenyl)-(2,3,4,5-tetrafluoro-6-tritylphenyl)boranuide (PubChem CID 139794522) has the molecular formula C43H19BF16 and a molecular weight of 850.41 g/mol. Its IUPAC name is hydron;tris(2,3,4,5-tetrafluorophenyl)-(2,3,4,5-tetrafluoro-6-tritylphenyl)boranuide.
| Compound Name | hydron;tris(2,3,4,5-tetrafluorophenyl)-(2,3,4,5-tetrafluoro-6-tritylphenyl)boranuide |
|---|---|
| PubChem CID | 139794522 |
| Molecular Formula | C43H19BF16 |
| Molecular Weight | 850.41 g/mol |
| Exact Mass | 850.13 |
| IUPAC Name | hydron;tris(2,3,4,5-tetrafluorophenyl)-(2,3,4,5-tetrafluoro-6-tritylphenyl)boranuide |
| SMILES | Fc1cc([B-](c2cc(F)c(F)c(F)c2F)(c2cc(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2C(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c(F)c1F.[H+] |
| InChI | InChI=1S/C43H18BF16/c45-25-16-22(30(48)38(56)33(25)51)44(23-17-26(46)34(52)39(57)31(23)49,24-18-27(47)35(53)40(58)32(24)50)29-28(36(54)41(59)42(60)37(29)55)43(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H/q-1/p+1 |
| InChIKey | DVJUOVQVHQUJQV-UHFFFAOYSA-O |
| XLogP | 9.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.41 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|