C27H12AlBF15O- — CID 87250875
(4-dimethylalumanyloxyphenyl)methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 87250875) has the molecular formula C27H12AlBF15O- and a molecular weight of 675.16 g/mol. Its IUPAC name is (4-dimethylalumanyloxyphenyl)methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (4-dimethylalumanyloxyphenyl)methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 87250875 |
| Molecular Formula | C27H12AlBF15O- |
| Molecular Weight | 675.16 g/mol |
| Exact Mass | 675.06 |
| IUPAC Name | (4-dimethylalumanyloxyphenyl)methyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[Al](C)Oc1ccc(C[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H7BF15O.2CH3.Al/c27-11-8(12(28)18(34)23(39)17(11)33)26(5-6-1-3-7(42)4-2-6,9-13(29)19(35)24(40)20(36)14(9)30)10-15(31)21(37)25(41)22(38)16(10)32;;;/h1-4,42H,5H2;2*1H3;/q-1;;;+1/p-1 |
| InChIKey | SAQYVWLIGGTZPK-UHFFFAOYSA-M |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.16 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|