C15H11F4NO2 — CID 59116242
4-[(2,3,5,6-tetrafluoro-4-methylphenyl)methylamino]benzoic acid (PubChem CID 59116242) has the molecular formula C15H11F4NO2 and a molecular weight of 313.25 g/mol. Its IUPAC name is 4-[(2,3,5,6-tetrafluoro-4-methylphenyl)methylamino]benzoic acid.
| Compound Name | 4-[(2,3,5,6-tetrafluoro-4-methylphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 59116242 |
| Molecular Formula | C15H11F4NO2 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-[(2,3,5,6-tetrafluoro-4-methylphenyl)methylamino]benzoic acid |
| SMILES | Cc1c(F)c(F)c(CNc2ccc(C(=O)O)cc2)c(F)c1F |
| InChI | InChI=1S/C15H11F4NO2/c1-7-11(16)13(18)10(14(19)12(7)17)6-20-9-4-2-8(3-5-9)15(21)22/h2-5,20H,6H2,1H3,(H,21,22) |
| InChIKey | JNQBEOSSNUWHBG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|