C18H6F16S — CID 87128445
1,2,3,4,5-pentafluoro-6-[3,3,3-trifluoro-1-[3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]sulfanylpropyl]benzene (PubChem CID 87128445) has the molecular formula C18H6F16S and a molecular weight of 558.28 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[3,3,3-trifluoro-1-[3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]sulfanylpropyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[3,3,3-trifluoro-1-[3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]sulfanylpropyl]benzene |
|---|---|
| PubChem CID | 87128445 |
| Molecular Formula | C18H6F16S |
| Molecular Weight | 558.28 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[3,3,3-trifluoro-1-[3,3,3-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)propyl]sulfanylpropyl]benzene |
| SMILES | Fc1c(F)c(F)c(C(CC(F)(F)F)SC(CC(F)(F)F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18H6F16S/c19-7-5(8(20)12(24)15(27)11(7)23)3(1-17(29,30)31)35-4(2-18(32,33)34)6-9(21)13(25)16(28)14(26)10(6)22/h3-4H,1-2H2 |
| InChIKey | NLABPERWHQTONU-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.28 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|