C10H6F8O — CID 115808677
4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol (PubChem CID 115808677) has the molecular formula C10H6F8O and a molecular weight of 294.14 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol.
| Compound Name | 4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 115808677 |
| Molecular Formula | C10H6F8O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol |
| SMILES | OC(CCC(F)(F)F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H6F8O/c11-5-4(3(19)1-2-10(16,17)18)6(12)8(14)9(15)7(5)13/h3,19H,1-2H2 |
| InChIKey | POYPSWXUSFYERN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|