C10H8ClF5O — CID 115808880
1-(4-chloro-2,5-difluorophenyl)-4,4,4-trifluorobutan-1-ol (PubChem CID 115808880) has the molecular formula C10H8ClF5O and a molecular weight of 274.62 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 115808880 |
| Molecular Formula | C10H8ClF5O |
| Molecular Weight | 274.62 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-4,4,4-trifluorobutan-1-ol |
| SMILES | OC(CCC(F)(F)F)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C10H8ClF5O/c11-6-4-7(12)5(3-8(6)13)9(17)1-2-10(14,15)16/h3-4,9,17H,1-2H2 |
| InChIKey | CBIBRXKXZKCAAM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|