C12H14F4O — CID 115828331
5,5,5-trifluoro-1-(2-fluoro-4-methylphenyl)pentan-1-ol (PubChem CID 115828331) has the molecular formula C12H14F4O and a molecular weight of 250.23 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(2-fluoro-4-methylphenyl)pentan-1-ol.
| Compound Name | 5,5,5-trifluoro-1-(2-fluoro-4-methylphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 115828331 |
| Molecular Formula | C12H14F4O |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5,5,5-trifluoro-1-(2-fluoro-4-methylphenyl)pentan-1-ol |
| SMILES | Cc1ccc(C(O)CCCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C12H14F4O/c1-8-4-5-9(10(13)7-8)11(17)3-2-6-12(14,15)16/h4-5,7,11,17H,2-3,6H2,1H3 |
| InChIKey | UWOLTOUTAZTEKN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |