C12H15F5N2 — CID 105329005
[1-(2,4-difluoro-5-methylphenyl)-5,5,5-trifluoropentyl]hydrazine (PubChem CID 105329005) has the molecular formula C12H15F5N2 and a molecular weight of 282.26 g/mol. Its IUPAC name is [1-(2,4-difluoro-5-methylphenyl)-5,5,5-trifluoropentyl]hydrazine.
| Compound Name | [1-(2,4-difluoro-5-methylphenyl)-5,5,5-trifluoropentyl]hydrazine |
|---|---|
| PubChem CID | 105329005 |
| Molecular Formula | C12H15F5N2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [1-(2,4-difluoro-5-methylphenyl)-5,5,5-trifluoropentyl]hydrazine |
| SMILES | Cc1cc(C(CCCC(F)(F)F)NN)c(F)cc1F |
| InChI | InChI=1S/C12H15F5N2/c1-7-5-8(10(14)6-9(7)13)11(19-18)3-2-4-12(15,16)17/h5-6,11,19H,2-4,18H2,1H3 |
| InChIKey | RHWXBQZGJHXZKZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|