C12H16F4N2O — CID 105256874
[5,5,5-trifluoro-1-(2-fluoro-4-methoxyphenyl)pentyl]hydrazine (PubChem CID 105256874) has the molecular formula C12H16F4N2O and a molecular weight of 280.27 g/mol. Its IUPAC name is [5,5,5-trifluoro-1-(2-fluoro-4-methoxyphenyl)pentyl]hydrazine.
| Compound Name | [5,5,5-trifluoro-1-(2-fluoro-4-methoxyphenyl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105256874 |
| Molecular Formula | C12H16F4N2O |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [5,5,5-trifluoro-1-(2-fluoro-4-methoxyphenyl)pentyl]hydrazine |
| SMILES | COc1ccc(C(CCCC(F)(F)F)NN)c(F)c1 |
| InChI | InChI=1S/C12H16F4N2O/c1-19-8-4-5-9(10(13)7-8)11(18-17)3-2-6-12(14,15)16/h4-5,7,11,18H,2-3,6,17H2,1H3 |
| InChIKey | JEDIGHZDUPSOFO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|