C13H21FN2O2 — CID 103397813
[1-(2-fluoro-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]ethyl]hydrazine (PubChem CID 103397813) has the molecular formula C13H21FN2O2 and a molecular weight of 256.32 g/mol. Its IUPAC name is [1-(2-fluoro-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]ethyl]hydrazine.
| Compound Name | [1-(2-fluoro-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]ethyl]hydrazine |
|---|---|
| PubChem CID | 103397813 |
| Molecular Formula | C13H21FN2O2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | [1-(2-fluoro-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]ethyl]hydrazine |
| SMILES | COc1ccc(C(COC(C)(C)C)NN)c(F)c1 |
| InChI | InChI=1S/C13H21FN2O2/c1-13(2,3)18-8-12(16-15)10-6-5-9(17-4)7-11(10)14/h5-7,12,16H,8,15H2,1-4H3 |
| InChIKey | JGYVELKZFKZRLV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|