C11H17FN2O2 — CID 103397541
[1-(2-fluoro-4-methoxyphenyl)-3-methoxypropyl]hydrazine (PubChem CID 103397541) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is [1-(2-fluoro-4-methoxyphenyl)-3-methoxypropyl]hydrazine.
| Compound Name | [1-(2-fluoro-4-methoxyphenyl)-3-methoxypropyl]hydrazine |
|---|---|
| PubChem CID | 103397541 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [1-(2-fluoro-4-methoxyphenyl)-3-methoxypropyl]hydrazine |
| SMILES | COCCC(NN)c1ccc(OC)cc1F |
| InChI | InChI=1S/C11H17FN2O2/c1-15-6-5-11(14-13)9-4-3-8(16-2)7-10(9)12/h3-4,7,11,14H,5-6,13H2,1-2H3 |
| InChIKey | FYVPLDLQNYYANU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|