C11H17FN2OS — CID 103397758
[1-(2-fluoro-4-methoxyphenyl)-3-methylsulfanylpropyl]hydrazine (PubChem CID 103397758) has the molecular formula C11H17FN2OS and a molecular weight of 244.33 g/mol. Its IUPAC name is [1-(2-fluoro-4-methoxyphenyl)-3-methylsulfanylpropyl]hydrazine.
| Compound Name | [1-(2-fluoro-4-methoxyphenyl)-3-methylsulfanylpropyl]hydrazine |
|---|---|
| PubChem CID | 103397758 |
| Molecular Formula | C11H17FN2OS |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | [1-(2-fluoro-4-methoxyphenyl)-3-methylsulfanylpropyl]hydrazine |
| SMILES | COc1ccc(C(CCSC)NN)c(F)c1 |
| InChI | InChI=1S/C11H17FN2OS/c1-15-8-3-4-9(10(12)7-8)11(14-13)5-6-16-2/h3-4,7,11,14H,5-6,13H2,1-2H3 |
| InChIKey | HBXUSIJRWOESDV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|