C11H17FN2S — CID 105302462
[1-(4-fluoro-2-methylphenyl)-3-methylsulfanylpropyl]hydrazine (PubChem CID 105302462) has the molecular formula C11H17FN2S and a molecular weight of 228.34 g/mol. Its IUPAC name is [1-(4-fluoro-2-methylphenyl)-3-methylsulfanylpropyl]hydrazine.
| Compound Name | [1-(4-fluoro-2-methylphenyl)-3-methylsulfanylpropyl]hydrazine |
|---|---|
| PubChem CID | 105302462 |
| Molecular Formula | C11H17FN2S |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [1-(4-fluoro-2-methylphenyl)-3-methylsulfanylpropyl]hydrazine |
| SMILES | CSCCC(NN)c1ccc(F)cc1C |
| InChI | InChI=1S/C11H17FN2S/c1-8-7-9(12)3-4-10(8)11(14-13)5-6-15-2/h3-4,7,11,14H,5-6,13H2,1-2H3 |
| InChIKey | UAIRLESOWCXIPT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|