C11H15FN2 — CID 105256687
1-(4-fluoro-2-methylphenyl)but-3-enylhydrazine (PubChem CID 105256687) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)but-3-enylhydrazine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)but-3-enylhydrazine |
|---|---|
| PubChem CID | 105256687 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)but-3-enylhydrazine |
| SMILES | C=CCC(NN)c1ccc(F)cc1C |
| InChI | InChI=1S/C11H15FN2/c1-3-4-11(14-13)10-6-5-9(12)7-8(10)2/h3,5-7,11,14H,1,4,13H2,2H3 |
| InChIKey | KFVNAHTXVFDEEO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|