C15H24FNOS — CID 111565172
1-(4-fluoro-2-methylphenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]ethanol (PubChem CID 111565172) has the molecular formula C15H24FNOS and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]ethanol.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 111565172 |
| Molecular Formula | C15H24FNOS |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]ethanol |
| SMILES | CSCCC(C)N(C)CC(O)c1ccc(F)cc1C |
| InChI | InChI=1S/C15H24FNOS/c1-11-9-13(16)5-6-14(11)15(18)10-17(3)12(2)7-8-19-4/h5-6,9,12,15,18H,7-8,10H2,1-4H3 |
| InChIKey | PMRWFEUUBBRSTK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |