C16H26FN — CID 114210914
1-(2-fluoro-4-methylphenyl)-N,5,5-trimethylhexan-1-amine (PubChem CID 114210914) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-N,5,5-trimethylhexan-1-amine.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-N,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 114210914 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-N,5,5-trimethylhexan-1-amine |
| SMILES | CNC(CCCC(C)(C)C)c1ccc(C)cc1F |
| InChI | InChI=1S/C16H26FN/c1-12-8-9-13(14(17)11-12)15(18-5)7-6-10-16(2,3)4/h8-9,11,15,18H,6-7,10H2,1-5H3 |
| InChIKey | ZROJMPAHNKVDLR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |