C17H29N — CID 114211088
1-(2-ethylphenyl)-N,5,5-trimethylhexan-1-amine (PubChem CID 114211088) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-N,5,5-trimethylhexan-1-amine.
| Compound Name | 1-(2-ethylphenyl)-N,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 114211088 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 1-(2-ethylphenyl)-N,5,5-trimethylhexan-1-amine |
| SMILES | CCc1ccccc1C(CCCC(C)(C)C)NC |
| InChI | InChI=1S/C17H29N/c1-6-14-10-7-8-11-15(14)16(18-5)12-9-13-17(2,3)4/h7-8,10-11,16,18H,6,9,12-13H2,1-5H3 |
| InChIKey | NXRPCKGNIHWWSR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |