C13H17ClF2O — CID 115829819
1-(4-chloro-2,5-difluorophenyl)-3-ethylpentan-1-ol (PubChem CID 115829819) has the molecular formula C13H17ClF2O and a molecular weight of 262.73 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-3-ethylpentan-1-ol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-3-ethylpentan-1-ol |
|---|---|
| PubChem CID | 115829819 |
| Molecular Formula | C13H17ClF2O |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-3-ethylpentan-1-ol |
| SMILES | CCC(CC)CC(O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H17ClF2O/c1-3-8(4-2)5-13(17)9-6-12(16)10(14)7-11(9)15/h6-8,13,17H,3-5H2,1-2H3 |
| InChIKey | NDCDAKRLYVQMJZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|