C16H15ClF2O — CID 115791241
1-(4-chloro-2,5-difluorophenyl)-4-phenylbutan-1-ol (PubChem CID 115791241) has the molecular formula C16H15ClF2O and a molecular weight of 296.74 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-4-phenylbutan-1-ol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 115791241 |
| Molecular Formula | C16H15ClF2O |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-4-phenylbutan-1-ol |
| SMILES | OC(CCCc1ccccc1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C16H15ClF2O/c17-13-10-14(18)12(9-15(13)19)16(20)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,16,20H,4,7-8H2 |
| InChIKey | XKAKMUABECYGJL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|