C8H6BrCl2FO — CID 83001570
(1R)-2-bromo-1-(2,4-dichloro-5-fluorophenyl)ethanol (PubChem CID 83001570) has the molecular formula C8H6BrCl2FO and a molecular weight of 287.94 g/mol. Its IUPAC name is (1R)-2-bromo-1-(2,4-dichloro-5-fluorophenyl)ethanol.
| Compound Name | (1R)-2-bromo-1-(2,4-dichloro-5-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 83001570 |
| Molecular Formula | C8H6BrCl2FO |
| Molecular Weight | 287.94 g/mol |
| Exact Mass | 285.90 |
| IUPAC Name | (1R)-2-bromo-1-(2,4-dichloro-5-fluorophenyl)ethanol |
| SMILES | O[C@@H](CBr)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H6BrCl2FO/c9-3-8(13)4-1-7(12)6(11)2-5(4)10/h1-2,8,13H,3H2/t8-/m0/s1 |
| InChIKey | ITYRMVOQRLRBSC-QMMMGPOBSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|