C13H15ClF5N — CID 105023875
1-(4-chloro-2,5-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine (PubChem CID 105023875) has the molecular formula C13H15ClF5N and a molecular weight of 315.71 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 105023875 |
| Molecular Formula | C13H15ClF5N |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine |
| SMILES | CCNC(CCCC(F)(F)F)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H15ClF5N/c1-2-20-12(4-3-5-13(17,18)19)8-6-11(16)9(14)7-10(8)15/h6-7,12,20H,2-5H2,1H3 |
| InChIKey | FYRQZVUCOCFVNW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|