C13H15BrF5N — CID 107539337
1-(2-bromo-3,4-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine (PubChem CID 107539337) has the molecular formula C13H15BrF5N and a molecular weight of 360.16 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 107539337 |
| Molecular Formula | C13H15BrF5N |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine |
| SMILES | CCNC(CCCC(F)(F)F)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C13H15BrF5N/c1-2-20-10(4-3-7-13(17,18)19)8-5-6-9(15)12(16)11(8)14/h5-6,10,20H,2-4,7H2,1H3 |
| InChIKey | FVGQWMJXCNDPMG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|