C13H16BrF2N — CID 107539190
1-(2-bromo-3,4-difluorophenyl)-N-ethylpent-4-en-1-amine (PubChem CID 107539190) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-N-ethylpent-4-en-1-amine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-N-ethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 107539190 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-N-ethylpent-4-en-1-amine |
| SMILES | C=CCCC(NCC)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C13H16BrF2N/c1-3-5-6-11(17-4-2)9-7-8-10(15)13(16)12(9)14/h3,7-8,11,17H,1,4-6H2,2H3 |
| InChIKey | JFRDTHFAYXTIAA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|