C14H19F2N — CID 104986798
1-(2,3-difluorophenyl)-N-ethylhex-5-en-1-amine (PubChem CID 104986798) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N-ethylhex-5-en-1-amine.
| Compound Name | 1-(2,3-difluorophenyl)-N-ethylhex-5-en-1-amine |
|---|---|
| PubChem CID | 104986798 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N-ethylhex-5-en-1-amine |
| SMILES | C=CCCCC(NCC)c1cccc(F)c1F |
| InChI | InChI=1S/C14H19F2N/c1-3-5-6-10-13(17-4-2)11-8-7-9-12(15)14(11)16/h3,7-9,13,17H,1,4-6,10H2,2H3 |
| InChIKey | CYDSIGHAAIMOSP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|