C14H20BrF2NO2S — CID 107539486
1-(2-bromo-3,4-difluorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine (PubChem CID 107539486) has the molecular formula C14H20BrF2NO2S and a molecular weight of 384.29 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 107539486 |
| Molecular Formula | C14H20BrF2NO2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C14H20BrF2NO2S/c1-3-8-18-12(5-4-9-21(2,19)20)10-6-7-11(16)14(17)13(10)15/h6-7,12,18H,3-5,8-9H2,1-2H3 |
| InChIKey | CRBLAYYLRNJMSB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|