C12H16F3NO2S — CID 115848221
N-ethyl-3-methylsulfonyl-1-(2,3,4-trifluorophenyl)propan-1-amine (PubChem CID 115848221) has the molecular formula C12H16F3NO2S and a molecular weight of 295.33 g/mol. Its IUPAC name is N-ethyl-3-methylsulfonyl-1-(2,3,4-trifluorophenyl)propan-1-amine.
| Compound Name | N-ethyl-3-methylsulfonyl-1-(2,3,4-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 115848221 |
| Molecular Formula | C12H16F3NO2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-ethyl-3-methylsulfonyl-1-(2,3,4-trifluorophenyl)propan-1-amine |
| SMILES | CCNC(CCS(C)(=O)=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H16F3NO2S/c1-3-16-10(6-7-19(2,17)18)8-4-5-9(13)12(15)11(8)14/h4-5,10,16H,3,6-7H2,1-2H3 |
| InChIKey | ZXAHHAYILOEJIZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|