C14H14F3NS — CID 55156959
N-ethyl-2-thiophen-2-yl-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 55156959) has the molecular formula C14H14F3NS and a molecular weight of 285.33 g/mol. Its IUPAC name is N-ethyl-2-thiophen-2-yl-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | N-ethyl-2-thiophen-2-yl-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 55156959 |
| Molecular Formula | C14H14F3NS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-ethyl-2-thiophen-2-yl-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | CCNC(Cc1cccs1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H14F3NS/c1-2-18-12(8-9-4-3-7-19-9)10-5-6-11(15)14(17)13(10)16/h3-7,12,18H,2,8H2,1H3 |
| InChIKey | DANOGKLCDDNQIU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|