C13H13F3N2S — CID 105308798
[3-thiophen-2-yl-1-(2,3,4-trifluorophenyl)propyl]hydrazine (PubChem CID 105308798) has the molecular formula C13H13F3N2S and a molecular weight of 286.32 g/mol. Its IUPAC name is [3-thiophen-2-yl-1-(2,3,4-trifluorophenyl)propyl]hydrazine.
| Compound Name | [3-thiophen-2-yl-1-(2,3,4-trifluorophenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 105308798 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [3-thiophen-2-yl-1-(2,3,4-trifluorophenyl)propyl]hydrazine |
| SMILES | NNC(CCc1cccs1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H13F3N2S/c14-10-5-4-9(12(15)13(10)16)11(18-17)6-3-8-2-1-7-19-8/h1-2,4-5,7,11,18H,3,6,17H2 |
| InChIKey | SBJJIQWEUIQEJJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|