C9H11F3N2S — CID 105213752
[2-methylsulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine (PubChem CID 105213752) has the molecular formula C9H11F3N2S and a molecular weight of 236.26 g/mol. Its IUPAC name is [2-methylsulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine.
| Compound Name | [2-methylsulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105213752 |
| Molecular Formula | C9H11F3N2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | [2-methylsulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine |
| SMILES | CSCC(NN)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H11F3N2S/c1-15-4-7(14-13)5-2-3-6(10)9(12)8(5)11/h2-3,7,14H,4,13H2,1H3 |
| InChIKey | RSJTUTUHBZOYRA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|