C14H12F4N2S — CID 105236101
[2-(2-fluorophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine (PubChem CID 105236101) has the molecular formula C14H12F4N2S and a molecular weight of 316.32 g/mol. Its IUPAC name is [2-(2-fluorophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(2-fluorophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105236101 |
| Molecular Formula | C14H12F4N2S |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [2-(2-fluorophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)ethyl]hydrazine |
| SMILES | NNC(CSc1ccccc1F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H12F4N2S/c15-9-3-1-2-4-12(9)21-7-11(20-19)8-5-6-10(16)14(18)13(8)17/h1-6,11,20H,7,19H2 |
| InChIKey | UHMJDHCOECWWQY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|