C14H17FN4S — CID 105236310
3-[2-(2-fluorophenyl)sulfanyl-1-hydrazinylethyl]-5-methylpyridin-2-amine (PubChem CID 105236310) has the molecular formula C14H17FN4S and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)sulfanyl-1-hydrazinylethyl]-5-methylpyridin-2-amine.
| Compound Name | 3-[2-(2-fluorophenyl)sulfanyl-1-hydrazinylethyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105236310 |
| Molecular Formula | C14H17FN4S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[2-(2-fluorophenyl)sulfanyl-1-hydrazinylethyl]-5-methylpyridin-2-amine |
| SMILES | Cc1cnc(N)c(C(CSc2ccccc2F)NN)c1 |
| InChI | InChI=1S/C14H17FN4S/c1-9-6-10(14(16)18-7-9)12(19-17)8-20-13-5-3-2-4-11(13)15/h2-7,12,19H,8,17H2,1H3,(H2,16,18) |
| InChIKey | JBQWZNGKNXVSRP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|