C9H16N4 — CID 105201163
3-(1-hydrazinylpropyl)-5-methylpyridin-2-amine (PubChem CID 105201163) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(1-hydrazinylpropyl)-5-methylpyridin-2-amine.
| Compound Name | 3-(1-hydrazinylpropyl)-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105201163 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3-(1-hydrazinylpropyl)-5-methylpyridin-2-amine |
| SMILES | CCC(NN)c1cc(C)cnc1N |
| InChI | InChI=1S/C9H16N4/c1-3-8(13-11)7-4-6(2)5-12-9(7)10/h4-5,8,13H,3,11H2,1-2H3,(H2,10,12) |
| InChIKey | DGPXFIJPWCFTGC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|