C15H13ClF3NS — CID 66140362
2-(2-chlorophenyl)sulfanyl-N-methyl-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 66140362) has the molecular formula C15H13ClF3NS and a molecular weight of 331.79 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-methyl-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-methyl-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 66140362 |
| Molecular Formula | C15H13ClF3NS |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-methyl-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | CNC(CSc1ccccc1Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H13ClF3NS/c1-20-12(8-21-13-5-3-2-4-10(13)16)9-6-7-11(17)15(19)14(9)18/h2-7,12,20H,8H2,1H3 |
| InChIKey | XGCCVNACEKFNNI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|